C16H13N3O4 — CID 7776835
2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-5-nitrobenzonitrile (PubChem CID 7776835) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is 2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-5-nitrobenzonitrile.
| Compound Name | 2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 7776835 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C16H13N3O4/c17-8-11-7-12(19(20)21)5-6-14(11)18-9-13-10-22-15-3-1-2-4-16(15)23-13/h1-7,13,18H,9-10H2/t13-/m0/s1 |
| InChIKey | AZSCMGJLKOGNIV-ZDUSSCGKSA-N |
| XLogP | 2.72 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|