C12H13Cl2NO4S2 — CID 142770459
3,3-dichloro-14-nitro-2,11-dioxa-5,8-dithiabicyclo[10.4.0]hexadeca-1(12),13,15-triene (PubChem CID 142770459) has the molecular formula C12H13Cl2NO4S2 and a molecular weight of 370.28 g/mol. Its IUPAC name is 3,3-dichloro-14-nitro-2,11-dioxa-5,8-dithiabicyclo[10.4.0]hexadeca-1(12),13,15-triene.
| Compound Name | 3,3-dichloro-14-nitro-2,11-dioxa-5,8-dithiabicyclo[10.4.0]hexadeca-1(12),13,15-triene |
|---|---|
| PubChem CID | 142770459 |
| Molecular Formula | C12H13Cl2NO4S2 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 3,3-dichloro-14-nitro-2,11-dioxa-5,8-dithiabicyclo[10.4.0]hexadeca-1(12),13,15-triene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)OCCSCCSCC(Cl)(Cl)O2 |
| InChI | InChI=1S/C12H13Cl2NO4S2/c13-12(14)8-21-6-5-20-4-3-18-11-7-9(15(16)17)1-2-10(11)19-12/h1-2,7H,3-6,8H2 |
| InChIKey | XTPFLKQDKIFYHE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|