C9H8N2O4 — CID 88795265
(NE)-N-(6-nitro-2,3-dihydrochromen-4-ylidene)hydroxylamine (PubChem CID 88795265) has the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. Its IUPAC name is (NE)-N-(6-nitro-2,3-dihydrochromen-4-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(6-nitro-2,3-dihydrochromen-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 88795265 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | (NE)-N-(6-nitro-2,3-dihydrochromen-4-ylidene)hydroxylamine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)/C(=N/O)CCO2 |
| InChI | InChI=1S/C9H8N2O4/c12-10-8-3-4-15-9-2-1-6(11(13)14)5-7(8)9/h1-2,5,12H,3-4H2/b10-8+ |
| InChIKey | XQLQPWHFSVXJFA-CSKARUKUSA-N |
| XLogP | 1.56 |
| TPSA | 84.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|