C16H13NO5 — CID 33494891
1-(2,3-dihydro-1-benzofuran-5-yl)-2-(4-nitrophenoxy)ethanone (PubChem CID 33494891) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-2-(4-nitrophenoxy)ethanone.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-2-(4-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 33494891 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-2-(4-nitrophenoxy)ethanone |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H13NO5/c18-15(11-1-6-16-12(9-11)7-8-21-16)10-22-14-4-2-13(3-5-14)17(19)20/h1-6,9H,7-8,10H2 |
| InChIKey | ZGZJBNWQMOTFSI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|