C11H9NO5 — CID 67763549
(2E)-2-(6-nitro-2,3-dihydrochromen-4-ylidene)acetic acid (PubChem CID 67763549) has the molecular formula C11H9NO5 and a molecular weight of 235.19 g/mol. Its IUPAC name is (2E)-2-(6-nitro-2,3-dihydrochromen-4-ylidene)acetic acid.
| Compound Name | (2E)-2-(6-nitro-2,3-dihydrochromen-4-ylidene)acetic acid |
|---|---|
| PubChem CID | 67763549 |
| Molecular Formula | C11H9NO5 |
| Molecular Weight | 235.19 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | (2E)-2-(6-nitro-2,3-dihydrochromen-4-ylidene)acetic acid |
| SMILES | O=C(O)/C=C1\CCOc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C11H9NO5/c13-11(14)5-7-3-4-17-10-2-1-8(12(15)16)6-9(7)10/h1-2,5-6H,3-4H2,(H,13,14)/b7-5+ |
| InChIKey | QOTLNBHHLOIFQM-FNORWQNLSA-N |
| XLogP | 1.85 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|