C18H21N3O5 — CID 123202960
tert-butyl 2-[[(3E)-1-imino-3-(6-nitro-2,3-dihydrochromen-4-ylidene)propan-2-ylidene]amino]acetate (PubChem CID 123202960) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is tert-butyl 2-[[(3E)-1-imino-3-(6-nitro-2,3-dihydrochromen-4-ylidene)propan-2-ylidene]amino]acetate.
| Compound Name | tert-butyl 2-[[(3E)-1-imino-3-(6-nitro-2,3-dihydrochromen-4-ylidene)propan-2-ylidene]amino]acetate |
|---|---|
| PubChem CID | 123202960 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | tert-butyl 2-[[(3E)-1-imino-3-(6-nitro-2,3-dihydrochromen-4-ylidene)propan-2-ylidene]amino]acetate |
| SMILES | [H]/N=C/C(/C=C1\CCOc2ccc([N+](=O)[O-])cc21)=N\CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H21N3O5/c1-18(2,3)26-17(22)11-20-13(10-19)8-12-6-7-25-16-5-4-14(21(23)24)9-15(12)16/h4-5,8-10,19H,6-7,11H2,1-3H3/b12-8+,19-10+,20-13- |
| InChIKey | FOJGELXDFXVBET-ATPOJTJHSA-N |
| XLogP | 3.19 |
| TPSA | 114.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|