C18H25N3O4 — CID 174470265
tert-butyl N-[3-methyl-4-(6-nitro-2,3-dihydroindol-1-yl)butylidene]carbamate (PubChem CID 174470265) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-4-(6-nitro-2,3-dihydroindol-1-yl)butylidene]carbamate.
| Compound Name | tert-butyl N-[3-methyl-4-(6-nitro-2,3-dihydroindol-1-yl)butylidene]carbamate |
|---|---|
| PubChem CID | 174470265 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | tert-butyl N-[3-methyl-4-(6-nitro-2,3-dihydroindol-1-yl)butylidene]carbamate |
| SMILES | CC(CC=NC(=O)OC(C)(C)C)CN1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C18H25N3O4/c1-13(7-9-19-17(22)25-18(2,3)4)12-20-10-8-14-5-6-15(21(23)24)11-16(14)20/h5-6,9,11,13H,7-8,10,12H2,1-4H3 |
| InChIKey | ISCXWICWORHXIV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|