About N-ethenyl-2-(6-nitro-2,3-dihydroindol-1-yl)-N-[(Z)-propylideneamino]ethanamine
N-ethenyl-2-(6-nitro-2,3-dihydroindol-1-yl)-N-[(Z)-propylideneamino]ethanamine (PubChem CID 156801818) has the molecular formula C15H20N4O2
and a molecular weight of 288.35 g/mol. Its IUPAC name is N-ethenyl-2-(6-nitro-2,3-dihydroindol-1-yl)-N-[(Z)-propylideneamino]ethanamine.
Molecular Properties
| Compound Name | N-ethenyl-2-(6-nitro-2,3-dihydroindol-1-yl)-N-[(Z)-propylideneamino]ethanamine |
| PubChem CID | 156801818 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-ethenyl-2-(6-nitro-2,3-dihydroindol-1-yl)-N-[(Z)-propylideneamino]ethanamine |
| SMILES | C=CN(CCN1CCc2ccc([N+](=O)[O-])cc21)/N=C\CC |
| InChI | InChI=1S/C15H20N4O2/c1-3-8-16-18(4-2)11-10-17-9-7-13-5-6-14(19(20)21)12-15(13)17/h4-6,8,12H,2-3,7,9-11H2,1H3/b16-8- |
| InChIKey | QRZRFNJDCXSYKH-PXNMLYILSA-N |
| XLogP | 2.80 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-2-(6-nitro-2,3-dihydroindol-1-yl)-N-[(Z)-propylideneamino]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-2-(6-nitro-2,3-dihydroindol-1-yl)-N-[(Z)-propylideneamino]ethanamine?
The IUPAC name of N-ethenyl-2-(6-nitro-2,3-dihydroindol-1-yl)-N-[(Z)-propylideneamino]ethanamine (CID 156801818) is N-ethenyl-2-(6-nitro-2,3-dihydroindol-1-yl)-N-[(Z)-propylideneamino]ethanamine.
What is the SMILES notation for N-ethenyl-2-(6-nitro-2,3-dihydroindol-1-yl)-N-[(Z)-propylideneamino]ethanamine?
The canonical SMILES for N-ethenyl-2-(6-nitro-2,3-dihydroindol-1-yl)-N-[(Z)-propylideneamino]ethanamine is C=CN(CCN1CCc2ccc([N+](=O)[O-])cc21)/N=C\CC.
What is the InChIKey of N-ethenyl-2-(6-nitro-2,3-dihydroindol-1-yl)-N-[(Z)-propylideneamino]ethanamine?
The InChIKey is QRZRFNJDCXSYKH-PXNMLYILSA-N. The full InChI is InChI=1S/C15H20N4O2/c1-3-8-16-18(4-2)11-10-17-9-7-13-5-6-14(19(20)21)12-15(13)17/h4-6,8,12H,2-3,7,9-11H2,1H3/b16-8-.
What are the key properties of N-ethenyl-2-(6-nitro-2,3-dihydroindol-1-yl)-N-[(Z)-propylideneamino]ethanamine?
N-ethenyl-2-(6-nitro-2,3-dihydroindol-1-yl)-N-[(Z)-propylideneamino]ethanamine has a molecular weight of 288.35 g/mol, XLogP of 2.80, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-2-(6-nitro-2,3-dihydroindol-1-yl)-N-[(Z)-propylideneamino]ethanamine is sourced from PubChem (CID 156801818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).