C12H13N5O2 — CID 86789587
1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-nitro-2,3-dihydroindole (PubChem CID 86789587) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-nitro-2,3-dihydroindole.
| Compound Name | 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-nitro-2,3-dihydroindole |
|---|---|
| PubChem CID | 86789587 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-nitro-2,3-dihydroindole |
| SMILES | Cn1cnnc1CN1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C12H13N5O2/c1-15-8-13-14-12(15)7-16-5-4-9-2-3-10(17(18)19)6-11(9)16/h2-3,6,8H,4-5,7H2,1H3 |
| InChIKey | IDRYXRCHNPKSER-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|