C10H9BrN4O3 — CID 102975282
3-[(2-bromo-5-nitrophenoxy)methyl]-4-methyl-1,2,4-triazole (PubChem CID 102975282) has the molecular formula C10H9BrN4O3 and a molecular weight of 313.11 g/mol. Its IUPAC name is 3-[(2-bromo-5-nitrophenoxy)methyl]-4-methyl-1,2,4-triazole.
| Compound Name | 3-[(2-bromo-5-nitrophenoxy)methyl]-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 102975282 |
| Molecular Formula | C10H9BrN4O3 |
| Molecular Weight | 313.11 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 3-[(2-bromo-5-nitrophenoxy)methyl]-4-methyl-1,2,4-triazole |
| SMILES | Cn1cnnc1COc1cc([N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C10H9BrN4O3/c1-14-6-12-13-10(14)5-18-9-4-7(15(16)17)2-3-8(9)11/h2-4,6H,5H2,1H3 |
| InChIKey | JEUBZGIJTUDCEA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.11 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|