C13H13BrN2O3S — CID 102975294
4-[(2-bromo-5-nitrophenoxy)methyl]-2-propan-2-yl-1,3-thiazole (PubChem CID 102975294) has the molecular formula C13H13BrN2O3S and a molecular weight of 357.23 g/mol. Its IUPAC name is 4-[(2-bromo-5-nitrophenoxy)methyl]-2-propan-2-yl-1,3-thiazole.
| Compound Name | 4-[(2-bromo-5-nitrophenoxy)methyl]-2-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 102975294 |
| Molecular Formula | C13H13BrN2O3S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 4-[(2-bromo-5-nitrophenoxy)methyl]-2-propan-2-yl-1,3-thiazole |
| SMILES | CC(C)c1nc(COc2cc([N+](=O)[O-])ccc2Br)cs1 |
| InChI | InChI=1S/C13H13BrN2O3S/c1-8(2)13-15-9(7-20-13)6-19-12-5-10(16(17)18)3-4-11(12)14/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | QEWORDKGQANIOF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|