C11H9ClO3 — CID 70360379
2-(6-chloro-2,3-dihydrochromen-4-ylidene)acetic acid (PubChem CID 70360379) has the molecular formula C11H9ClO3 and a molecular weight of 224.64 g/mol. Its IUPAC name is 2-(6-chloro-2,3-dihydrochromen-4-ylidene)acetic acid.
| Compound Name | 2-(6-chloro-2,3-dihydrochromen-4-ylidene)acetic acid |
|---|---|
| PubChem CID | 70360379 |
| Molecular Formula | C11H9ClO3 |
| Molecular Weight | 224.64 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 2-(6-chloro-2,3-dihydrochromen-4-ylidene)acetic acid |
| SMILES | O=C(O)C=C1CCOc2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H9ClO3/c12-8-1-2-10-9(6-8)7(3-4-15-10)5-11(13)14/h1-2,5-6H,3-4H2,(H,13,14) |
| InChIKey | VHZGCECEIMMMGD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.64 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|