C14H15ClO2 — CID 84634049
(2E)-2-(7-chloro-4,4-dimethyl-2,3-dihydronaphthalen-1-ylidene)acetic acid (PubChem CID 84634049) has the molecular formula C14H15ClO2 and a molecular weight of 250.72 g/mol. Its IUPAC name is (2E)-2-(7-chloro-4,4-dimethyl-2,3-dihydronaphthalen-1-ylidene)acetic acid.
| Compound Name | (2E)-2-(7-chloro-4,4-dimethyl-2,3-dihydronaphthalen-1-ylidene)acetic acid |
|---|---|
| PubChem CID | 84634049 |
| Molecular Formula | C14H15ClO2 |
| Molecular Weight | 250.72 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (2E)-2-(7-chloro-4,4-dimethyl-2,3-dihydronaphthalen-1-ylidene)acetic acid |
| SMILES | CC1(C)CC/C(=C\C(=O)O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C14H15ClO2/c1-14(2)6-5-9(7-13(16)17)11-8-10(15)3-4-12(11)14/h3-4,7-8H,5-6H2,1-2H3,(H,16,17)/b9-7+ |
| InChIKey | KRHHNWVIMHQYQB-VQHVLOKHSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.72 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|