C11H7ClO3 — CID 171716962
(2E)-2-(5-chloro-3-oxo-1H-inden-2-ylidene)acetic acid (PubChem CID 171716962) has the molecular formula C11H7ClO3 and a molecular weight of 222.63 g/mol. Its IUPAC name is (2E)-2-(5-chloro-3-oxo-1H-inden-2-ylidene)acetic acid.
| Compound Name | (2E)-2-(5-chloro-3-oxo-1H-inden-2-ylidene)acetic acid |
|---|---|
| PubChem CID | 171716962 |
| Molecular Formula | C11H7ClO3 |
| Molecular Weight | 222.63 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | (2E)-2-(5-chloro-3-oxo-1H-inden-2-ylidene)acetic acid |
| SMILES | O=C(O)/C=C1\Cc2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C11H7ClO3/c12-8-2-1-6-3-7(4-10(13)14)11(15)9(6)5-8/h1-2,4-5H,3H2,(H,13,14)/b7-4+ |
| InChIKey | PUIMIHROCNUCLS-QPJJXVBHSA-N |
| XLogP | 2.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.63 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|