C21H17ClN2O2 — CID 45029104
4-[(E)-(5-chloro-3-oxo-1H-inden-2-ylidene)methyl]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 45029104) has the molecular formula C21H17ClN2O2 and a molecular weight of 364.83 g/mol. Its IUPAC name is 4-[(E)-(5-chloro-3-oxo-1H-inden-2-ylidene)methyl]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[(E)-(5-chloro-3-oxo-1H-inden-2-ylidene)methyl]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 45029104 |
| Molecular Formula | C21H17ClN2O2 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 4-[(E)-(5-chloro-3-oxo-1H-inden-2-ylidene)methyl]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/C=C2\Cc3ccc(Cl)cc3C2=O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C21H17ClN2O2/c1-13-18(21(26)24(23(13)2)17-6-4-3-5-7-17)11-15-10-14-8-9-16(22)12-19(14)20(15)25/h3-9,11-12H,10H2,1-2H3/b15-11+ |
| InChIKey | LSGNQNTYWSPIEJ-RVDMUPIBSA-N |
| XLogP | 3.96 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|