(2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid

C11H8Cl2O2 — CID 67563935

IUPAC(2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid
SMILESO=C(O)/C=C1\CCc2c(Cl)cc(Cl)cc21
InChIInChI=1S/C11H8Cl2O2/c12-7-4-9-6(3-11(14)15)1-2-8(9)10(13)5-7/h3-5H,1-2H2,(H,14,15)/b6-3+
InChIKeyWXKNXCIMRBEBQV-ZZXKWVIFSA-N
MW243.09 g/mol
LogP3.41
Rot. Bonds1

About (2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid

(2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid (PubChem CID 67563935) has the molecular formula C11H8Cl2O2 and a molecular weight of 243.09 g/mol. Its IUPAC name is (2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid.

Molecular Properties

Compound Name(2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid
PubChem CID67563935
Molecular FormulaC11H8Cl2O2
Molecular Weight243.09 g/mol
Exact Mass241.99
IUPAC Name(2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid
SMILESO=C(O)/C=C1\CCc2c(Cl)cc(Cl)cc21
InChIInChI=1S/C11H8Cl2O2/c12-7-4-9-6(3-11(14)15)1-2-8(9)10(13)5-7/h3-5H,1-2H2,(H,14,15)/b6-3+
InChIKeyWXKNXCIMRBEBQV-ZZXKWVIFSA-N
XLogP3.41
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.09
LogP ≤ 53.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid?
The IUPAC name of (2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid (CID 67563935) is (2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid.
What is the SMILES notation for (2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid?
The canonical SMILES for (2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid is O=C(O)/C=C1\CCc2c(Cl)cc(Cl)cc21.
What is the InChIKey of (2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid?
The InChIKey is WXKNXCIMRBEBQV-ZZXKWVIFSA-N. The full InChI is InChI=1S/C11H8Cl2O2/c12-7-4-9-6(3-11(14)15)1-2-8(9)10(13)5-7/h3-5H,1-2H2,(H,14,15)/b6-3+.
What are the key properties of (2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid?
(2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid has a molecular weight of 243.09 g/mol, XLogP of 3.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(4,6-dichloro-2,3-dihydroinden-1-ylidene)acetic acid is sourced from PubChem (CID 67563935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).