C11H9F2NO — CID 23293667
(2Z)-2-(4,6-difluoro-2,3-dihydroinden-1-ylidene)acetamide (PubChem CID 23293667) has the molecular formula C11H9F2NO and a molecular weight of 209.20 g/mol. Its IUPAC name is (2Z)-2-(4,6-difluoro-2,3-dihydroinden-1-ylidene)acetamide.
| Compound Name | (2Z)-2-(4,6-difluoro-2,3-dihydroinden-1-ylidene)acetamide |
|---|---|
| PubChem CID | 23293667 |
| Molecular Formula | C11H9F2NO |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (2Z)-2-(4,6-difluoro-2,3-dihydroinden-1-ylidene)acetamide |
| SMILES | NC(=O)/C=C1/CCc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C11H9F2NO/c12-7-4-9-6(3-11(14)15)1-2-8(9)10(13)5-7/h3-5H,1-2H2,(H2,14,15)/b6-3- |
| InChIKey | AQTRJSKRZHDGEX-UTCJRWHESA-N |
| XLogP | 1.78 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|