C14H13F2NO — CID 11747017
(2E)-N-cyclopropyl-2-(4,6-difluoro-2,3-dihydroinden-1-ylidene)acetamide (PubChem CID 11747017) has the molecular formula C14H13F2NO and a molecular weight of 249.26 g/mol. Its IUPAC name is (2E)-N-cyclopropyl-2-(4,6-difluoro-2,3-dihydroinden-1-ylidene)acetamide.
| Compound Name | (2E)-N-cyclopropyl-2-(4,6-difluoro-2,3-dihydroinden-1-ylidene)acetamide |
|---|---|
| PubChem CID | 11747017 |
| Molecular Formula | C14H13F2NO |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2E)-N-cyclopropyl-2-(4,6-difluoro-2,3-dihydroinden-1-ylidene)acetamide |
| SMILES | O=C(/C=C1\CCc2c(F)cc(F)cc21)NC1CC1 |
| InChI | InChI=1S/C14H13F2NO/c15-9-6-12-8(1-4-11(12)13(16)7-9)5-14(18)17-10-2-3-10/h5-7,10H,1-4H2,(H,17,18)/b8-5+ |
| InChIKey | GTJPGNFDSRZYSP-VMPITWQZSA-N |
| XLogP | 2.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|