C14H14BrNO — CID 19698778
(2Z)-2-(6-bromo-2,3-dihydroinden-1-ylidene)-N-cyclopropylacetamide (PubChem CID 19698778) has the molecular formula C14H14BrNO and a molecular weight of 292.18 g/mol. Its IUPAC name is (2Z)-2-(6-bromo-2,3-dihydroinden-1-ylidene)-N-cyclopropylacetamide.
| Compound Name | (2Z)-2-(6-bromo-2,3-dihydroinden-1-ylidene)-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 19698778 |
| Molecular Formula | C14H14BrNO |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | (2Z)-2-(6-bromo-2,3-dihydroinden-1-ylidene)-N-cyclopropylacetamide |
| SMILES | O=C(/C=C1/CCc2ccc(Br)cc21)NC1CC1 |
| InChI | InChI=1S/C14H14BrNO/c15-11-4-3-9-1-2-10(13(9)8-11)7-14(17)16-12-5-6-12/h3-4,7-8,12H,1-2,5-6H2,(H,16,17)/b10-7- |
| InChIKey | KVCNDHUKCOHVCI-YFHOEESVSA-N |
| XLogP | 3.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|