C12H11BrO — CID 121003853
(2Z)-2-(7-bromo-3,4-dihydro-2H-naphthalen-1-ylidene)acetaldehyde (PubChem CID 121003853) has the molecular formula C12H11BrO and a molecular weight of 251.12 g/mol. Its IUPAC name is (2Z)-2-(7-bromo-3,4-dihydro-2H-naphthalen-1-ylidene)acetaldehyde.
| Compound Name | (2Z)-2-(7-bromo-3,4-dihydro-2H-naphthalen-1-ylidene)acetaldehyde |
|---|---|
| PubChem CID | 121003853 |
| Molecular Formula | C12H11BrO |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | (2Z)-2-(7-bromo-3,4-dihydro-2H-naphthalen-1-ylidene)acetaldehyde |
| SMILES | O=C/C=C1/CCCc2ccc(Br)cc21 |
| InChI | InChI=1S/C12H11BrO/c13-11-5-4-9-2-1-3-10(6-7-14)12(9)8-11/h4-8H,1-3H2/b10-6- |
| InChIKey | NTZCBVSJIKVFPN-POHAHGRESA-N |
| XLogP | 3.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|