About (7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium
(7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium (PubChem CID 166448024) has the molecular formula C10H7BrORh
and a molecular weight of 325.98 g/mol. Its IUPAC name is (7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium.
Molecular Properties
| Compound Name | (7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium |
| PubChem CID | 166448024 |
| Molecular Formula | C10H7BrORh |
| Molecular Weight | 325.98 g/mol |
| Exact Mass | 324.87 |
| IUPAC Name | (7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium |
| SMILES | O=C1CCc2ccc(Br)cc2C1=[Rh] |
| InChI | InChI=1S/C10H7BrO.Rh/c11-9-3-1-7-2-4-10(12)6-8(7)5-9;/h1,3,5H,2,4H2; |
| InChIKey | ISOACFVVGUXJHT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.98 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'} |
|---|
Analyze (7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium?
The IUPAC name of (7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium (CID 166448024) is (7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium.
What is the SMILES notation for (7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium?
The canonical SMILES for (7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium is O=C1CCc2ccc(Br)cc2C1=[Rh].
What is the InChIKey of (7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium?
The InChIKey is ISOACFVVGUXJHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrO.Rh/c11-9-3-1-7-2-4-10(12)6-8(7)5-9;/h1,3,5H,2,4H2;.
What are the key properties of (7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium?
(7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium has a molecular weight of 325.98 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium is sourced from PubChem (CID 166448024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).