C10H7BrORh — CID 166448024
(7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium (PubChem CID 166448024) has the molecular formula C10H7BrORh and a molecular weight of 325.98 g/mol. Its IUPAC name is (7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium.
| Compound Name | (7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium |
|---|---|
| PubChem CID | 166448024 |
| Molecular Formula | C10H7BrORh |
| Molecular Weight | 325.98 g/mol |
| Exact Mass | 324.87 |
| IUPAC Name | (7-bromo-2-oxo-3,4-dihydronaphthalen-1-ylidene)rhodium |
| SMILES | O=C1CCc2ccc(Br)cc2C1=[Rh] |
| InChI | InChI=1S/C10H7BrO.Rh/c11-9-3-1-7-2-4-10(12)6-8(7)5-9;/h1,3,5H,2,4H2; |
| InChIKey | ISOACFVVGUXJHT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.98 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'} |
|---|