C14H18BrNOS — CID 89253723
(NE,R)-N-(7-bromo-3,4-dihydro-2H-naphthalen-1-ylidene)-2-methylpropane-2-sulfinamide (PubChem CID 89253723) has the molecular formula C14H18BrNOS and a molecular weight of 328.28 g/mol. Its IUPAC name is (NE,R)-N-(7-bromo-3,4-dihydro-2H-naphthalen-1-ylidene)-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-(7-bromo-3,4-dihydro-2H-naphthalen-1-ylidene)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 89253723 |
| Molecular Formula | C14H18BrNOS |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | (NE,R)-N-(7-bromo-3,4-dihydro-2H-naphthalen-1-ylidene)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C1\CCCc2ccc(Br)cc21 |
| InChI | InChI=1S/C14H18BrNOS/c1-14(2,3)18(17)16-13-6-4-5-10-7-8-11(15)9-12(10)13/h7-9H,4-6H2,1-3H3/b16-13+/t18-/m1/s1 |
| InChIKey | UFSMTZSNFWQJJD-IYICPGQYSA-N |
| XLogP | 4.04 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|