C13H16BrNOS2 — CID 71078808
(R)-N-(6-bromo-2,3-dihydrothiochromen-4-ylidene)-2-methylpropane-2-sulfinamide (PubChem CID 71078808) has the molecular formula C13H16BrNOS2 and a molecular weight of 346.32 g/mol. Its IUPAC name is (R)-N-(6-bromo-2,3-dihydrothiochromen-4-ylidene)-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-(6-bromo-2,3-dihydrothiochromen-4-ylidene)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 71078808 |
| Molecular Formula | C13H16BrNOS2 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | (R)-N-(6-bromo-2,3-dihydrothiochromen-4-ylidene)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N=C1CCSc2ccc(Br)cc21 |
| InChI | InChI=1S/C13H16BrNOS2/c1-13(2,3)18(16)15-11-6-7-17-12-5-4-9(14)8-10(11)12/h4-5,8H,6-7H2,1-3H3/t18-/m1/s1 |
| InChIKey | POKCKDZLDKFZSS-GOSISDBHSA-N |
| XLogP | 4.20 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|