C14H16N2OS — CID 129225428
(NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide (PubChem CID 129225428) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is (NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide.
| Compound Name | (NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 129225428 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)/N=C1/CCc2c(C#N)cccc21 |
| InChI | InChI=1S/C14H16N2OS/c1-14(2,3)18(17)16-13-8-7-11-10(9-15)5-4-6-12(11)13/h4-6H,7-8H2,1-3H3/b16-13- |
| InChIKey | YPHURAORAWVSCR-SSZFMOIBSA-N |
| XLogP | 2.76 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|