About (NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide
(NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide (PubChem CID 129225428) has the molecular formula C14H16N2OS
and a molecular weight of 260.36 g/mol. Its IUPAC name is (NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide |
| PubChem CID | 129225428 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)/N=C1/CCc2c(C#N)cccc21 |
| InChI | InChI=1S/C14H16N2OS/c1-14(2,3)18(17)16-13-8-7-11-10(9-15)5-4-6-12(11)13/h4-6H,7-8H2,1-3H3/b16-13- |
| InChIKey | YPHURAORAWVSCR-SSZFMOIBSA-N |
| XLogP | 2.76 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide?
The IUPAC name of (NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide (CID 129225428) is (NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide?
The canonical SMILES for (NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide is CC(C)(C)S(=O)/N=C1/CCc2c(C#N)cccc21.
What is the InChIKey of (NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide?
The InChIKey is YPHURAORAWVSCR-SSZFMOIBSA-N. The full InChI is InChI=1S/C14H16N2OS/c1-14(2,3)18(17)16-13-8-7-11-10(9-15)5-4-6-12(11)13/h4-6H,7-8H2,1-3H3/b16-13-.
What are the key properties of (NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide?
(NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide has a molecular weight of 260.36 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-(4-cyano-2,3-dihydroinden-1-ylidene)-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 129225428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).