C19H27NO3S — CID 177458044
tert-butyl 2-[(1R,3Z)-3-tert-butylsulfinylimino-1,2-dihydroinden-1-yl]acetate (PubChem CID 177458044) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is tert-butyl 2-[(1R,3Z)-3-tert-butylsulfinylimino-1,2-dihydroinden-1-yl]acetate.
| Compound Name | tert-butyl 2-[(1R,3Z)-3-tert-butylsulfinylimino-1,2-dihydroinden-1-yl]acetate |
|---|---|
| PubChem CID | 177458044 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | tert-butyl 2-[(1R,3Z)-3-tert-butylsulfinylimino-1,2-dihydroinden-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1C/C(=N/S(=O)C(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C19H27NO3S/c1-18(2,3)23-17(21)12-13-11-16(20-24(22)19(4,5)6)15-10-8-7-9-14(13)15/h7-10,13H,11-12H2,1-6H3/b20-16-/t13-,24?/m1/s1 |
| InChIKey | NZSSRBILJZULPV-WYZGFNFISA-N |
| XLogP | 4.16 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|