C18H16BrFN2OS — CID 59596253
(NE)-N-[(3-bromo-4-fluorophenyl)-(2-cyanophenyl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 59596253) has the molecular formula C18H16BrFN2OS and a molecular weight of 407.31 g/mol. Its IUPAC name is (NE)-N-[(3-bromo-4-fluorophenyl)-(2-cyanophenyl)methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE)-N-[(3-bromo-4-fluorophenyl)-(2-cyanophenyl)methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 59596253 |
| Molecular Formula | C18H16BrFN2OS |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | (NE)-N-[(3-bromo-4-fluorophenyl)-(2-cyanophenyl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)/N=C(\c1ccc(F)c(Br)c1)c1ccccc1C#N |
| InChI | InChI=1S/C18H16BrFN2OS/c1-18(2,3)24(23)22-17(12-8-9-16(20)15(19)10-12)14-7-5-4-6-13(14)11-21/h4-10H,1-3H3/b22-17+ |
| InChIKey | WSEDMBPCARXHIB-OQKWZONESA-N |
| XLogP | 4.76 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|