C9H8BrNOS — CID 88720010
(NE)-N-(6-bromo-2,3-dihydrothiochromen-4-ylidene)hydroxylamine (PubChem CID 88720010) has the molecular formula C9H8BrNOS and a molecular weight of 258.14 g/mol. Its IUPAC name is (NE)-N-(6-bromo-2,3-dihydrothiochromen-4-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(6-bromo-2,3-dihydrothiochromen-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 88720010 |
| Molecular Formula | C9H8BrNOS |
| Molecular Weight | 258.14 g/mol |
| Exact Mass | 256.95 |
| IUPAC Name | (NE)-N-(6-bromo-2,3-dihydrothiochromen-4-ylidene)hydroxylamine |
| SMILES | O/N=C1\CCSc2ccc(Br)cc21 |
| InChI | InChI=1S/C9H8BrNOS/c10-6-1-2-9-7(5-6)8(11-12)3-4-13-9/h1-2,5,12H,3-4H2/b11-8+ |
| InChIKey | UEHZHZJNVRTLMC-DHZHZOJOSA-N |
| XLogP | 3.12 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.14 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|