About 7-bromo-5-pyridin-2-yl-2,3-dihydro-1,4-benzothiazepine
7-bromo-5-pyridin-2-yl-2,3-dihydro-1,4-benzothiazepine (PubChem CID 154111953) has the molecular formula C14H11BrN2S
and a molecular weight of 319.23 g/mol. Its IUPAC name is 7-bromo-5-pyridin-2-yl-2,3-dihydro-1,4-benzothiazepine.
Molecular Properties
| Compound Name | 7-bromo-5-pyridin-2-yl-2,3-dihydro-1,4-benzothiazepine |
| PubChem CID | 154111953 |
| Molecular Formula | C14H11BrN2S |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 7-bromo-5-pyridin-2-yl-2,3-dihydro-1,4-benzothiazepine |
| SMILES | Brc1ccc2c(c1)C(c1ccccn1)=NCCS2 |
| InChI | InChI=1S/C14H11BrN2S/c15-10-4-5-13-11(9-10)14(17-7-8-18-13)12-3-1-2-6-16-12/h1-6,9H,7-8H2 |
| InChIKey | AJOGEZHHNFUDSH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-5-pyridin-2-yl-2,3-dihydro-1,4-benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5-pyridin-2-yl-2,3-dihydro-1,4-benzothiazepine?
The IUPAC name of 7-bromo-5-pyridin-2-yl-2,3-dihydro-1,4-benzothiazepine (CID 154111953) is 7-bromo-5-pyridin-2-yl-2,3-dihydro-1,4-benzothiazepine.
What is the SMILES notation for 7-bromo-5-pyridin-2-yl-2,3-dihydro-1,4-benzothiazepine?
The canonical SMILES for 7-bromo-5-pyridin-2-yl-2,3-dihydro-1,4-benzothiazepine is Brc1ccc2c(c1)C(c1ccccn1)=NCCS2.
What is the InChIKey of 7-bromo-5-pyridin-2-yl-2,3-dihydro-1,4-benzothiazepine?
The InChIKey is AJOGEZHHNFUDSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrN2S/c15-10-4-5-13-11(9-10)14(17-7-8-18-13)12-3-1-2-6-16-12/h1-6,9H,7-8H2.
What are the key properties of 7-bromo-5-pyridin-2-yl-2,3-dihydro-1,4-benzothiazepine?
7-bromo-5-pyridin-2-yl-2,3-dihydro-1,4-benzothiazepine has a molecular weight of 319.23 g/mol, XLogP of 3.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5-pyridin-2-yl-2,3-dihydro-1,4-benzothiazepine is sourced from PubChem (CID 154111953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).