About 3,6-dibromo-1,8-dipyridin-2-yl-9H-carbazole
3,6-dibromo-1,8-dipyridin-2-yl-9H-carbazole (PubChem CID 102596077) has the molecular formula C22H13Br2N3
and a molecular weight of 479.18 g/mol. Its IUPAC name is 3,6-dibromo-1,8-dipyridin-2-yl-9H-carbazole.
Molecular Properties
| Compound Name | 3,6-dibromo-1,8-dipyridin-2-yl-9H-carbazole |
| PubChem CID | 102596077 |
| Molecular Formula | C22H13Br2N3 |
| Molecular Weight | 479.18 g/mol |
| Exact Mass | 476.95 |
| IUPAC Name | 3,6-dibromo-1,8-dipyridin-2-yl-9H-carbazole |
| SMILES | Brc1cc(-c2ccccn2)c2[nH]c3c(-c4ccccn4)cc(Br)cc3c2c1 |
| InChI | InChI=1S/C22H13Br2N3/c23-13-9-15-16-10-14(24)12-18(20-6-2-4-8-26-20)22(16)27-21(15)17(11-13)19-5-1-3-7-25-19/h1-12,27H |
| InChIKey | NOHIJAROJALNNZ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.18 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dibromo-1,8-dipyridin-2-yl-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dibromo-1,8-dipyridin-2-yl-9H-carbazole?
The IUPAC name of 3,6-dibromo-1,8-dipyridin-2-yl-9H-carbazole (CID 102596077) is 3,6-dibromo-1,8-dipyridin-2-yl-9H-carbazole.
What is the SMILES notation for 3,6-dibromo-1,8-dipyridin-2-yl-9H-carbazole?
The canonical SMILES for 3,6-dibromo-1,8-dipyridin-2-yl-9H-carbazole is Brc1cc(-c2ccccn2)c2[nH]c3c(-c4ccccn4)cc(Br)cc3c2c1.
What is the InChIKey of 3,6-dibromo-1,8-dipyridin-2-yl-9H-carbazole?
The InChIKey is NOHIJAROJALNNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13Br2N3/c23-13-9-15-16-10-14(24)12-18(20-6-2-4-8-26-20)22(16)27-21(15)17(11-13)19-5-1-3-7-25-19/h1-12,27H.
What are the key properties of 3,6-dibromo-1,8-dipyridin-2-yl-9H-carbazole?
3,6-dibromo-1,8-dipyridin-2-yl-9H-carbazole has a molecular weight of 479.18 g/mol, XLogP of 6.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dibromo-1,8-dipyridin-2-yl-9H-carbazole is sourced from PubChem (CID 102596077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).