C18H16BrN5O2 — CID 54203391
methyl 2-[(7-bromo-5-pyridin-2-yl-3H-1,4-benzodiazepin-2-yl)hydrazinylidene]propanoate (PubChem CID 54203391) has the molecular formula C18H16BrN5O2 and a molecular weight of 414.26 g/mol. Its IUPAC name is methyl 2-[(7-bromo-5-pyridin-2-yl-3H-1,4-benzodiazepin-2-yl)hydrazinylidene]propanoate.
| Compound Name | methyl 2-[(7-bromo-5-pyridin-2-yl-3H-1,4-benzodiazepin-2-yl)hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 54203391 |
| Molecular Formula | C18H16BrN5O2 |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | methyl 2-[(7-bromo-5-pyridin-2-yl-3H-1,4-benzodiazepin-2-yl)hydrazinylidene]propanoate |
| SMILES | COC(=O)C(C)=NNC1=Nc2ccc(Br)cc2C(c2ccccn2)=NC1 |
| InChI | InChI=1S/C18H16BrN5O2/c1-11(18(25)26-2)23-24-16-10-21-17(15-5-3-4-8-20-15)13-9-12(19)6-7-14(13)22-16/h3-9H,10H2,1-2H3,(H,22,24) |
| InChIKey | PQUQXNMZSNSSFG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|