C16H15FN2S — CID 9060522
N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-3-methylaniline (PubChem CID 9060522) has the molecular formula C16H15FN2S and a molecular weight of 286.38 g/mol. Its IUPAC name is N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-3-methylaniline.
| Compound Name | N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-3-methylaniline |
|---|---|
| PubChem CID | 9060522 |
| Molecular Formula | C16H15FN2S |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-3-methylaniline |
| SMILES | Cc1cccc(NN=C2CCSc3ccc(F)cc32)c1 |
| InChI | InChI=1S/C16H15FN2S/c1-11-3-2-4-13(9-11)18-19-15-7-8-20-16-6-5-12(17)10-14(15)16/h2-6,9-10,18H,7-8H2,1H3 |
| InChIKey | LZRDFDUBAQSJGV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|