C18H18N2O — CID 46196409
(6Z)-6-[(3-methylphenyl)hydrazinylidene]-8,9-dihydro-7H-benzo[7]annulen-5-one (PubChem CID 46196409) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is (6Z)-6-[(3-methylphenyl)hydrazinylidene]-8,9-dihydro-7H-benzo[7]annulen-5-one.
| Compound Name | (6Z)-6-[(3-methylphenyl)hydrazinylidene]-8,9-dihydro-7H-benzo[7]annulen-5-one |
|---|---|
| PubChem CID | 46196409 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (6Z)-6-[(3-methylphenyl)hydrazinylidene]-8,9-dihydro-7H-benzo[7]annulen-5-one |
| SMILES | Cc1cccc(N/N=C2/CCCc3ccccc3C2=O)c1 |
| InChI | InChI=1S/C18H18N2O/c1-13-6-4-9-15(12-13)19-20-17-11-5-8-14-7-2-3-10-16(14)18(17)21/h2-4,6-7,9-10,12,19H,5,8,11H2,1H3/b20-17- |
| InChIKey | RLHGLZMPPOWZJZ-JZJYNLBNSA-N |
| XLogP | 3.98 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|