C15H12Cl3N3 — CID 3889948
3,5,6-trichloro-N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)pyridin-2-amine (PubChem CID 3889948) has the molecular formula C15H12Cl3N3 and a molecular weight of 340.64 g/mol. Its IUPAC name is 3,5,6-trichloro-N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)pyridin-2-amine |
|---|---|
| PubChem CID | 3889948 |
| Molecular Formula | C15H12Cl3N3 |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 3,5,6-trichloro-N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)pyridin-2-amine |
| SMILES | Clc1cc(Cl)c(NN=C2CCCc3ccccc32)nc1Cl |
| InChI | InChI=1S/C15H12Cl3N3/c16-11-8-12(17)15(19-14(11)18)21-20-13-7-3-5-9-4-1-2-6-10(9)13/h1-2,4,6,8H,3,5,7H2,(H,19,21) |
| InChIKey | FZNXUTMLOLOFNJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|