C19H21FN4O2S2 — CID 94724995
N-[(Z)-(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-5-piperidin-1-ylsulfonylpyridin-2-amine (PubChem CID 94724995) has the molecular formula C19H21FN4O2S2 and a molecular weight of 420.54 g/mol. Its IUPAC name is N-[(Z)-(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-5-piperidin-1-ylsulfonylpyridin-2-amine.
| Compound Name | N-[(Z)-(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-5-piperidin-1-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 94724995 |
| Molecular Formula | C19H21FN4O2S2 |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-[(Z)-(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-5-piperidin-1-ylsulfonylpyridin-2-amine |
| SMILES | O=S(=O)(c1ccc(N/N=C2/CCSc3ccc(F)cc32)nc1)N1CCCCC1 |
| InChI | InChI=1S/C19H21FN4O2S2/c20-14-4-6-18-16(12-14)17(8-11-27-18)22-23-19-7-5-15(13-21-19)28(25,26)24-9-2-1-3-10-24/h4-7,12-13H,1-3,8-11H2,(H,21,23)/b22-17- |
| InChIKey | YWVGHQISOYEJGR-XLNRJJMWSA-N |
| XLogP | 3.71 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|