C18H23FN5O3S+ — CID 135846484
4-fluoro-2-[(E)-C-methyl-N-[[5-(4-methylpiperazin-4-ium-1-yl)sulfonyl-2-pyridinyl]amino]carbonimidoyl]phenol (PubChem CID 135846484) has the molecular formula C18H23FN5O3S+ and a molecular weight of 408.48 g/mol. Its IUPAC name is 4-fluoro-2-[(E)-C-methyl-N-[[5-(4-methylpiperazin-4-ium-1-yl)sulfonyl-2-pyridinyl]amino]carbonimidoyl]phenol.
| Compound Name | 4-fluoro-2-[(E)-C-methyl-N-[[5-(4-methylpiperazin-4-ium-1-yl)sulfonyl-2-pyridinyl]amino]carbonimidoyl]phenol |
|---|---|
| PubChem CID | 135846484 |
| Molecular Formula | C18H23FN5O3S+ |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 4-fluoro-2-[(E)-C-methyl-N-[[5-(4-methylpiperazin-4-ium-1-yl)sulfonyl-2-pyridinyl]amino]carbonimidoyl]phenol |
| SMILES | C/C(=N\Nc1ccc(S(=O)(=O)N2CC[NH+](C)CC2)cn1)c1cc(F)ccc1O |
| InChI | InChI=1S/C18H22FN5O3S/c1-13(16-11-14(19)3-5-17(16)25)21-22-18-6-4-15(12-20-18)28(26,27)24-9-7-23(2)8-10-24/h3-6,11-12,25H,7-10H2,1-2H3,(H,20,22)/p+1/b21-13+ |
| InChIKey | HEBSEAKIUWIISE-FYJGNVAPSA-O |
| XLogP | 0.28 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|