C18H18FN3O2S — CID 4541197
N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-2-(2-methoxyanilino)acetamide (PubChem CID 4541197) has the molecular formula C18H18FN3O2S and a molecular weight of 359.43 g/mol. Its IUPAC name is N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-2-(2-methoxyanilino)acetamide.
| Compound Name | N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-2-(2-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 4541197 |
| Molecular Formula | C18H18FN3O2S |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-2-(2-methoxyanilino)acetamide |
| SMILES | COc1ccccc1NCC(=O)NN=C1CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C18H18FN3O2S/c1-24-16-5-3-2-4-15(16)20-11-18(23)22-21-14-8-9-25-17-7-6-12(19)10-13(14)17/h2-7,10,20H,8-9,11H2,1H3,(H,22,23) |
| InChIKey | MCHJQFIFSLEFLY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|