C17H27N4O2+ — CID 7393779
2-(2-methoxyanilino)-N-[(1-propan-2-ylpiperidin-1-ium-4-ylidene)amino]acetamide (PubChem CID 7393779) has the molecular formula C17H27N4O2+ and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-N-[(1-propan-2-ylpiperidin-1-ium-4-ylidene)amino]acetamide.
| Compound Name | 2-(2-methoxyanilino)-N-[(1-propan-2-ylpiperidin-1-ium-4-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 7393779 |
| Molecular Formula | C17H27N4O2+ |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 2-(2-methoxyanilino)-N-[(1-propan-2-ylpiperidin-1-ium-4-ylidene)amino]acetamide |
| SMILES | COc1ccccc1NCC(=O)NN=C1CC[NH+](C(C)C)CC1 |
| InChI | InChI=1S/C17H26N4O2/c1-13(2)21-10-8-14(9-11-21)19-20-17(22)12-18-15-6-4-5-7-16(15)23-3/h4-7,13,18H,8-12H2,1-3H3,(H,20,22)/p+1 |
| InChIKey | FBFUUKZLPKIIBP-UHFFFAOYSA-O |
| XLogP | 0.67 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|