C19H21N3O2 — CID 6071350
N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-(2-methoxyanilino)acetamide (PubChem CID 6071350) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-(2-methoxyanilino)acetamide.
| Compound Name | N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-(2-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 6071350 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-(2-methoxyanilino)acetamide |
| SMILES | COc1ccccc1NCC(=O)N/N=C1\CCCc2ccccc21 |
| InChI | InChI=1S/C19H21N3O2/c1-24-18-12-5-4-10-17(18)20-13-19(23)22-21-16-11-6-8-14-7-2-3-9-15(14)16/h2-5,7,9-10,12,20H,6,8,11,13H2,1H3,(H,22,23)/b21-16+ |
| InChIKey | RJUCBAJGBFSFKN-LTGZKZEYSA-N |
| XLogP | 2.96 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|