C18H26N2O — CID 6297520
N-[(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino]octanamide (PubChem CID 6297520) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is N-[(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino]octanamide.
| Compound Name | N-[(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino]octanamide |
|---|---|
| PubChem CID | 6297520 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | N-[(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino]octanamide |
| SMILES | CCCCCCCC(=O)N/N=C1/CCCc2ccccc21 |
| InChI | InChI=1S/C18H26N2O/c1-2-3-4-5-6-14-18(21)20-19-17-13-9-11-15-10-7-8-12-16(15)17/h7-8,10,12H,2-6,9,11,13-14H2,1H3,(H,20,21)/b19-17- |
| InChIKey | PUQUMLUUZQBQRQ-ZPHPHTNESA-N |
| XLogP | 4.20 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|