C17H24N2O — CID 4097852
N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)heptanamide (PubChem CID 4097852) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)heptanamide.
| Compound Name | N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)heptanamide |
|---|---|
| PubChem CID | 4097852 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)heptanamide |
| SMILES | CCCCCCC(=O)NN=C1CCCc2ccccc21 |
| InChI | InChI=1S/C17H24N2O/c1-2-3-4-5-13-17(20)19-18-16-12-8-10-14-9-6-7-11-15(14)16/h6-7,9,11H,2-5,8,10,12-13H2,1H3,(H,19,20) |
| InChIKey | RTKAINUPXMBVMW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|