C21H22N2O4S — CID 172942933
N-[(E)-2,3-dihydrothiochromen-4-ylideneamino]-4-(3,4-dimethoxyphenyl)-4-oxobutanamide (PubChem CID 172942933) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is N-[(E)-2,3-dihydrothiochromen-4-ylideneamino]-4-(3,4-dimethoxyphenyl)-4-oxobutanamide.
| Compound Name | N-[(E)-2,3-dihydrothiochromen-4-ylideneamino]-4-(3,4-dimethoxyphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 172942933 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[(E)-2,3-dihydrothiochromen-4-ylideneamino]-4-(3,4-dimethoxyphenyl)-4-oxobutanamide |
| SMILES | COc1ccc(C(=O)CCC(=O)N/N=C2\CCSc3ccccc32)cc1OC |
| InChI | InChI=1S/C21H22N2O4S/c1-26-18-9-7-14(13-19(18)27-2)17(24)8-10-21(25)23-22-16-11-12-28-20-6-4-3-5-15(16)20/h3-7,9,13H,8,10-12H2,1-2H3,(H,23,25)/b22-16+ |
| InChIKey | MWQRVQWPYLCXTH-CJLVFECKSA-N |
| XLogP | 3.68 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|