C20H22N2O4S — CID 172951664
N-[(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]-4-(3,4-dimethoxyphenyl)-4-oxobutanamide (PubChem CID 172951664) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is N-[(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]-4-(3,4-dimethoxyphenyl)-4-oxobutanamide.
| Compound Name | N-[(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]-4-(3,4-dimethoxyphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 172951664 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-[(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino]-4-(3,4-dimethoxyphenyl)-4-oxobutanamide |
| SMILES | COc1ccc(C(=O)CCC(=O)N/N=C2\CCCc3sccc32)cc1OC |
| InChI | InChI=1S/C20H22N2O4S/c1-25-17-8-6-13(12-18(17)26-2)16(23)7-9-20(24)22-21-15-4-3-5-19-14(15)10-11-27-19/h6,8,10-12H,3-5,7,9H2,1-2H3,(H,22,24)/b21-15+ |
| InChIKey | MGNBNRXRLKNBOS-RCCKNPSSSA-N |
| XLogP | 3.59 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|