C9H11N3OS — CID 77022594
(6,7-dihydro-5H-1-benzothiophen-4-ylideneamino)urea (PubChem CID 77022594) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is (6,7-dihydro-5H-1-benzothiophen-4-ylideneamino)urea.
| Compound Name | (6,7-dihydro-5H-1-benzothiophen-4-ylideneamino)urea |
|---|---|
| PubChem CID | 77022594 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | (6,7-dihydro-5H-1-benzothiophen-4-ylideneamino)urea |
| SMILES | NC(=O)NN=C1CCCc2sccc21 |
| InChI | InChI=1S/C9H11N3OS/c10-9(13)12-11-7-2-1-3-8-6(7)4-5-14-8/h4-5H,1-3H2,(H3,10,12,13) |
| InChIKey | BGCPBLOHTBUQFO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|