C11H13N3OS — CID 71602932
[(E)-(5-hydroxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea (PubChem CID 71602932) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is [(E)-(5-hydroxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea.
| Compound Name | [(E)-(5-hydroxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 71602932 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | [(E)-(5-hydroxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea |
| SMILES | NC(=S)N/N=C1\CCCc2c(O)cccc21 |
| InChI | InChI=1S/C11H13N3OS/c12-11(16)14-13-9-5-1-4-8-7(9)3-2-6-10(8)15/h2-3,6,15H,1,4-5H2,(H3,12,14,16)/b13-9+ |
| InChIKey | UOPTWMZGUKRKMS-UKTHLTGXSA-N |
| XLogP | 1.27 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|