C18H14FN3O2S — CID 9467470
2-(2-cyanophenoxy)-N-[(Z)-(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]acetamide (PubChem CID 9467470) has the molecular formula C18H14FN3O2S and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[(Z)-(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[(Z)-(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 9467470 |
| Molecular Formula | C18H14FN3O2S |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[(Z)-(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]acetamide |
| SMILES | N#Cc1ccccc1OCC(=O)N/N=C1/CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C18H14FN3O2S/c19-13-5-6-17-14(9-13)15(7-8-25-17)21-22-18(23)11-24-16-4-2-1-3-12(16)10-20/h1-6,9H,7-8,11H2,(H,22,23)/b21-15- |
| InChIKey | XXTHALIVQGMQSB-QNGOZBTKSA-N |
| XLogP | 3.09 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|