C19H14F4N4OS — CID 4845594
N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide (PubChem CID 4845594) has the molecular formula C19H14F4N4OS and a molecular weight of 422.41 g/mol. Its IUPAC name is N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 4845594 |
| Molecular Formula | C19H14F4N4OS |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
| SMILES | O=C(Cn1c(C(F)(F)F)nc2ccccc21)NN=C1CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C19H14F4N4OS/c20-11-5-6-16-12(9-11)13(7-8-29-16)25-26-17(28)10-27-15-4-2-1-3-14(15)24-18(27)19(21,22)23/h1-6,9H,7-8,10H2,(H,26,28) |
| InChIKey | WDDPTQNMSALVLH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|