C19H17FN4OS — CID 9121307
N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-2-(2-methylbenzimidazol-1-yl)acetamide (PubChem CID 9121307) has the molecular formula C19H17FN4OS and a molecular weight of 368.44 g/mol. Its IUPAC name is N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-2-(2-methylbenzimidazol-1-yl)acetamide.
| Compound Name | N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-2-(2-methylbenzimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 9121307 |
| Molecular Formula | C19H17FN4OS |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-2-(2-methylbenzimidazol-1-yl)acetamide |
| SMILES | Cc1nc2ccccc2n1CC(=O)NN=C1CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C19H17FN4OS/c1-12-21-16-4-2-3-5-17(16)24(12)11-19(25)23-22-15-8-9-26-18-7-6-13(20)10-14(15)18/h2-7,10H,8-9,11H2,1H3,(H,23,25) |
| InChIKey | ZPZIFVBMNUPOTL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|