C15H14FN3OS2 — CID 4856859
N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 4856859) has the molecular formula C15H14FN3OS2 and a molecular weight of 335.43 g/mol. Its IUPAC name is N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 4856859 |
| Molecular Formula | C15H14FN3OS2 |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | Cc1nc(CC(=O)NN=C2CCSc3ccc(F)cc32)cs1 |
| InChI | InChI=1S/C15H14FN3OS2/c1-9-17-11(8-22-9)7-15(20)19-18-13-4-5-21-14-3-2-10(16)6-12(13)14/h2-3,6,8H,4-5,7H2,1H3,(H,19,20) |
| InChIKey | HDCSNSRNOAUUKZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|