C15H17FN2O3S2 — CID 8868997
2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]acetamide (PubChem CID 8868997) has the molecular formula C15H17FN2O3S2 and a molecular weight of 356.44 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]acetamide.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 8868997 |
| Molecular Formula | C15H17FN2O3S2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]acetamide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)NN=C1CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C15H17FN2O3S2/c16-11-1-2-14-12(8-11)13(3-5-22-14)17-18-15(19)7-10-4-6-23(20,21)9-10/h1-2,8,10H,3-7,9H2,(H,18,19)/t10-/m0/s1 |
| InChIKey | ARSGEPIDVUNYHQ-JTQLQIEISA-N |
| XLogP | 1.97 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|