C16H19FN2O4S — CID 135776816
2-[(3S)-1,1-dioxothiolan-3-yl]-N-[(E)-[(3R)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]acetamide (PubChem CID 135776816) has the molecular formula C16H19FN2O4S and a molecular weight of 354.40 g/mol. Its IUPAC name is 2-[(3S)-1,1-dioxothiolan-3-yl]-N-[(E)-[(3R)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]acetamide.
| Compound Name | 2-[(3S)-1,1-dioxothiolan-3-yl]-N-[(E)-[(3R)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]acetamide |
|---|---|
| PubChem CID | 135776816 |
| Molecular Formula | C16H19FN2O4S |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-[(3S)-1,1-dioxothiolan-3-yl]-N-[(E)-[(3R)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]acetamide |
| SMILES | C[C@@H]1C/C(=N\NC(=O)C[C@H]2CCS(=O)(=O)C2)c2c(O)ccc(F)c21 |
| InChI | InChI=1S/C16H19FN2O4S/c1-9-6-12(16-13(20)3-2-11(17)15(9)16)18-19-14(21)7-10-4-5-24(22,23)8-10/h2-3,9-10,20H,4-8H2,1H3,(H,19,21)/b18-12+/t9-,10-/m1/s1 |
| InChIKey | ZCIHYQYCMXAWIS-XXLBHUHLSA-N |
| XLogP | 1.68 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|